C12H22N2O2S2 — CID 54324609
[[1-(2-ethenylsulfanylethylsulfanyl)-3,3-dimethylbutan-2-ylidene]amino] N-methylcarbamate (PubChem CID 54324609) has the molecular formula C12H22N2O2S2 and a molecular weight of 290.45 g/mol. Its IUPAC name is [[1-(2-ethenylsulfanylethylsulfanyl)-3,3-dimethylbutan-2-ylidene]amino] N-methylcarbamate.
| Compound Name | [[1-(2-ethenylsulfanylethylsulfanyl)-3,3-dimethylbutan-2-ylidene]amino] N-methylcarbamate |
|---|---|
| PubChem CID | 54324609 |
| Molecular Formula | C12H22N2O2S2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | [[1-(2-ethenylsulfanylethylsulfanyl)-3,3-dimethylbutan-2-ylidene]amino] N-methylcarbamate |
| SMILES | C=CSCCSCC(=NOC(=O)NC)C(C)(C)C |
| InChI | InChI=1S/C12H22N2O2S2/c1-6-17-7-8-18-9-10(12(2,3)4)14-16-11(15)13-5/h6H,1,7-9H2,2-5H3,(H,13,15) |
| InChIKey | SUAJCXRBOFGXBV-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|