C16H29N5O4S2 — CID 87221909
2-cyanoethyl (1Z)-N-(methylcarbamoyloxy)ethanimidothioate;[(3,3-dimethyl-1-methylsulfanylbutan-2-ylidene)amino] N-methylcarbamate (PubChem CID 87221909) has the molecular formula C16H29N5O4S2 and a molecular weight of 419.57 g/mol. Its IUPAC name is 2-cyanoethyl (1Z)-N-(methylcarbamoyloxy)ethanimidothioate;[(3,3-dimethyl-1-methylsulfanylbutan-2-ylidene)amino] N-methylcarbamate.
| Compound Name | 2-cyanoethyl (1Z)-N-(methylcarbamoyloxy)ethanimidothioate;[(3,3-dimethyl-1-methylsulfanylbutan-2-ylidene)amino] N-methylcarbamate |
|---|---|
| PubChem CID | 87221909 |
| Molecular Formula | C16H29N5O4S2 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | 2-cyanoethyl (1Z)-N-(methylcarbamoyloxy)ethanimidothioate;[(3,3-dimethyl-1-methylsulfanylbutan-2-ylidene)amino] N-methylcarbamate |
| SMILES | CNC(=O)O/N=C(/C)SCCC#N.CNC(=O)ON=C(CSC)C(C)(C)C |
| InChI | InChI=1S/C9H18N2O2S.C7H11N3O2S/c1-9(2,3)7(6-14-5)11-13-8(12)10-4;1-6(13-5-3-4-8)10-12-7(11)9-2/h6H2,1-5H3,(H,10,12);3,5H2,1-2H3,(H,9,11)/b;10-6- |
| InChIKey | RRAIPKKPSYUCCI-HFVFTABDSA-N |
| XLogP | 3.43 |
| TPSA | 125.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|