C9H14N4O3S — CID 57103817
(2-amino-2-oxoethyl) 2-cyano-2-methyl-N-(methylcarbamoyloxy)propanimidothioate (PubChem CID 57103817) has the molecular formula C9H14N4O3S and a molecular weight of 258.30 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) 2-cyano-2-methyl-N-(methylcarbamoyloxy)propanimidothioate.
| Compound Name | (2-amino-2-oxoethyl) 2-cyano-2-methyl-N-(methylcarbamoyloxy)propanimidothioate |
|---|---|
| PubChem CID | 57103817 |
| Molecular Formula | C9H14N4O3S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | (2-amino-2-oxoethyl) 2-cyano-2-methyl-N-(methylcarbamoyloxy)propanimidothioate |
| SMILES | CNC(=O)ON=C(SCC(N)=O)C(C)(C)C#N |
| InChI | InChI=1S/C9H14N4O3S/c1-9(2,5-10)7(17-4-6(11)14)13-16-8(15)12-3/h4H2,1-3H3,(H2,11,14)(H,12,15) |
| InChIKey | KPYNXHSVWCASIF-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 117.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|