C8H14N4O5S — CID 54023924
(2-amino-2-oxoethyl) 2-methyl-N-(methylcarbamoyloxy)-2-nitropropanimidothioate (PubChem CID 54023924) has the molecular formula C8H14N4O5S and a molecular weight of 278.29 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) 2-methyl-N-(methylcarbamoyloxy)-2-nitropropanimidothioate.
| Compound Name | (2-amino-2-oxoethyl) 2-methyl-N-(methylcarbamoyloxy)-2-nitropropanimidothioate |
|---|---|
| PubChem CID | 54023924 |
| Molecular Formula | C8H14N4O5S |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | (2-amino-2-oxoethyl) 2-methyl-N-(methylcarbamoyloxy)-2-nitropropanimidothioate |
| SMILES | CNC(=O)ON=C(SCC(N)=O)C(C)(C)[N+](=O)[O-] |
| InChI | InChI=1S/C8H14N4O5S/c1-8(2,12(15)16)6(18-4-5(9)13)11-17-7(14)10-3/h4H2,1-3H3,(H2,9,13)(H,10,14) |
| InChIKey | LAVHORGQTSGUBE-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 136.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|