C9H16F2N2O2S — CID 88842126
[(Z)-[1-(difluoromethylsulfanyl)-3,3-dimethylbutan-2-ylidene]amino] N-methylcarbamate (PubChem CID 88842126) has the molecular formula C9H16F2N2O2S and a molecular weight of 254.30 g/mol. Its IUPAC name is [(Z)-[1-(difluoromethylsulfanyl)-3,3-dimethylbutan-2-ylidene]amino] N-methylcarbamate.
| Compound Name | [(Z)-[1-(difluoromethylsulfanyl)-3,3-dimethylbutan-2-ylidene]amino] N-methylcarbamate |
|---|---|
| PubChem CID | 88842126 |
| Molecular Formula | C9H16F2N2O2S |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | [(Z)-[1-(difluoromethylsulfanyl)-3,3-dimethylbutan-2-ylidene]amino] N-methylcarbamate |
| SMILES | CNC(=O)O/N=C(\CSC(F)F)C(C)(C)C |
| InChI | InChI=1S/C9H16F2N2O2S/c1-9(2,3)6(5-16-7(10)11)13-15-8(14)12-4/h7H,5H2,1-4H3,(H,12,14)/b13-6+ |
| InChIKey | NRHBAYGQVKGIAF-AWNIVKPZSA-N |
| XLogP | 2.70 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|