C10H20N2O3S2 — CID 12629016
[(Z)-(3,3-dimethyl-1-methylsulfanyl-1-methylsulfinylbutan-2-ylidene)amino] N-methylcarbamate (PubChem CID 12629016) has the molecular formula C10H20N2O3S2 and a molecular weight of 280.42 g/mol. Its IUPAC name is [(Z)-(3,3-dimethyl-1-methylsulfanyl-1-methylsulfinylbutan-2-ylidene)amino] N-methylcarbamate.
| Compound Name | [(Z)-(3,3-dimethyl-1-methylsulfanyl-1-methylsulfinylbutan-2-ylidene)amino] N-methylcarbamate |
|---|---|
| PubChem CID | 12629016 |
| Molecular Formula | C10H20N2O3S2 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | [(Z)-(3,3-dimethyl-1-methylsulfanyl-1-methylsulfinylbutan-2-ylidene)amino] N-methylcarbamate |
| SMILES | CNC(=O)O/N=C(\C(SC)S(C)=O)C(C)(C)C |
| InChI | InChI=1S/C10H20N2O3S2/c1-10(2,3)7(8(16-5)17(6)14)12-15-9(13)11-4/h8H,1-6H3,(H,11,13)/b12-7+ |
| InChIKey | SXDNYWSQOKSMRO-KPKJPENVSA-N |
| XLogP | 1.81 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|