C11H20N2O3S — CID 173461791
[(3,3-dimethyl-1-prop-2-enylsulfinylbutylidene)amino] N-methylcarbamate (PubChem CID 173461791) has the molecular formula C11H20N2O3S and a molecular weight of 260.36 g/mol. Its IUPAC name is [(3,3-dimethyl-1-prop-2-enylsulfinylbutylidene)amino] N-methylcarbamate.
| Compound Name | [(3,3-dimethyl-1-prop-2-enylsulfinylbutylidene)amino] N-methylcarbamate |
|---|---|
| PubChem CID | 173461791 |
| Molecular Formula | C11H20N2O3S |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | [(3,3-dimethyl-1-prop-2-enylsulfinylbutylidene)amino] N-methylcarbamate |
| SMILES | C=CCS(=O)C(CC(C)(C)C)=NOC(=O)NC |
| InChI | InChI=1S/C11H20N2O3S/c1-6-7-17(15)9(8-11(2,3)4)13-16-10(14)12-5/h6H,1,7-8H2,2-5H3,(H,12,14) |
| InChIKey | XDNPNTBJGMMPDS-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|