C9H14FN3O2 — CID 54563020
[(4-cyano-1-fluoro-3,3-dimethylbutan-2-ylidene)amino] N-methylcarbamate (PubChem CID 54563020) has the molecular formula C9H14FN3O2 and a molecular weight of 215.23 g/mol. Its IUPAC name is [(4-cyano-1-fluoro-3,3-dimethylbutan-2-ylidene)amino] N-methylcarbamate.
| Compound Name | [(4-cyano-1-fluoro-3,3-dimethylbutan-2-ylidene)amino] N-methylcarbamate |
|---|---|
| PubChem CID | 54563020 |
| Molecular Formula | C9H14FN3O2 |
| Molecular Weight | 215.23 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | [(4-cyano-1-fluoro-3,3-dimethylbutan-2-ylidene)amino] N-methylcarbamate |
| SMILES | CNC(=O)ON=C(CF)C(C)(C)CC#N |
| InChI | InChI=1S/C9H14FN3O2/c1-9(2,4-5-11)7(6-10)13-15-8(14)12-3/h4,6H2,1-3H3,(H,12,14) |
| InChIKey | ZRVXGWMCCNJSFM-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 74.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.23 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|