C9H20N2O — CID 11435211
(2S)-2-amino-N,N-diethyl-3-methylbutanamide (PubChem CID 11435211) has the molecular formula C9H20N2O and a molecular weight of 172.27 g/mol. Its IUPAC name is (2S)-2-amino-N,N-diethyl-3-methylbutanamide.
| Compound Name | (2S)-2-amino-N,N-diethyl-3-methylbutanamide |
|---|---|
| PubChem CID | 11435211 |
| Molecular Formula | C9H20N2O |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.16 |
| IUPAC Name | (2S)-2-amino-N,N-diethyl-3-methylbutanamide |
| SMILES | CCN(CC)C(=O)[C@@H](N)C(C)C |
| InChI | InChI=1S/C9H20N2O/c1-5-11(6-2)9(12)8(10)7(3)4/h7-8H,5-6,10H2,1-4H3/t8-/m0/s1 |
| InChIKey | VMRKJJQTRYRJRT-QMMMGPOBSA-N |
| XLogP | 0.84 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |