C9H17N3O — CID 23645883
(2S)-2-amino-N-(cyanomethyl)-N,3,3-trimethylbutanamide (PubChem CID 23645883) has the molecular formula C9H17N3O and a molecular weight of 183.25 g/mol. Its IUPAC name is (2S)-2-amino-N-(cyanomethyl)-N,3,3-trimethylbutanamide.
| Compound Name | (2S)-2-amino-N-(cyanomethyl)-N,3,3-trimethylbutanamide |
|---|---|
| PubChem CID | 23645883 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | (2S)-2-amino-N-(cyanomethyl)-N,3,3-trimethylbutanamide |
| SMILES | CN(CC#N)C(=O)[C@@H](N)C(C)(C)C |
| InChI | InChI=1S/C9H17N3O/c1-9(2,3)7(11)8(13)12(4)6-5-10/h7H,6,11H2,1-4H3/t7-/m1/s1 |
| InChIKey | XPGJDPLFMWNERF-SSDOTTSWSA-N |
| XLogP | 0.34 |
| TPSA | 70.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|