C12H23N3O — CID 23645884
(2S)-2-amino-N-butyl-N-(cyanomethyl)-3,3-dimethylbutanamide (PubChem CID 23645884) has the molecular formula C12H23N3O and a molecular weight of 225.34 g/mol. Its IUPAC name is (2S)-2-amino-N-butyl-N-(cyanomethyl)-3,3-dimethylbutanamide.
| Compound Name | (2S)-2-amino-N-butyl-N-(cyanomethyl)-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 23645884 |
| Molecular Formula | C12H23N3O |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | (2S)-2-amino-N-butyl-N-(cyanomethyl)-3,3-dimethylbutanamide |
| SMILES | CCCCN(CC#N)C(=O)[C@@H](N)C(C)(C)C |
| InChI | InChI=1S/C12H23N3O/c1-5-6-8-15(9-7-13)11(16)10(14)12(2,3)4/h10H,5-6,8-9,14H2,1-4H3/t10-/m1/s1 |
| InChIKey | PCWVHZMRXVIRBL-SNVBAGLBSA-N |
| XLogP | 1.51 |
| TPSA | 70.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|