C11H19N3O — CID 23645886
(2S)-2-amino-N-(cyanomethyl)-N-cyclopropyl-3,3-dimethylbutanamide (PubChem CID 23645886) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is (2S)-2-amino-N-(cyanomethyl)-N-cyclopropyl-3,3-dimethylbutanamide.
| Compound Name | (2S)-2-amino-N-(cyanomethyl)-N-cyclopropyl-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 23645886 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | (2S)-2-amino-N-(cyanomethyl)-N-cyclopropyl-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)[C@H](N)C(=O)N(CC#N)C1CC1 |
| InChI | InChI=1S/C11H19N3O/c1-11(2,3)9(13)10(15)14(7-6-12)8-4-5-8/h8-9H,4-5,7,13H2,1-3H3/t9-/m1/s1 |
| InChIKey | WTNOSBRNUHGJFQ-SECBINFHSA-N |
| XLogP | 0.87 |
| TPSA | 70.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|