C14H15N5S — CID 114354231
3-ethyl-6-(1,2,3,4-tetrahydroisoquinolin-5-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 114354231) has the molecular formula C14H15N5S and a molecular weight of 285.38 g/mol. Its IUPAC name is 3-ethyl-6-(1,2,3,4-tetrahydroisoquinolin-5-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 3-ethyl-6-(1,2,3,4-tetrahydroisoquinolin-5-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 114354231 |
| Molecular Formula | C14H15N5S |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 3-ethyl-6-(1,2,3,4-tetrahydroisoquinolin-5-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | CCc1nnc2sc(-c3cccc4c3CCNC4)nn12 |
| InChI | InChI=1S/C14H15N5S/c1-2-12-16-17-14-19(12)18-13(20-14)11-5-3-4-9-8-15-7-6-10(9)11/h3-5,15H,2,6-8H2,1H3 |
| InChIKey | LEVFIBHXVXYLBU-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |