C9H10N8OS — CID 114354942
5-[3-(oxolan-3-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]-1H-1,2,4-triazol-3-amine (PubChem CID 114354942) has the molecular formula C9H10N8OS and a molecular weight of 278.30 g/mol. Its IUPAC name is 5-[3-(oxolan-3-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]-1H-1,2,4-triazol-3-amine.
| Compound Name | 5-[3-(oxolan-3-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 114354942 |
| Molecular Formula | C9H10N8OS |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 5-[3-(oxolan-3-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]-1H-1,2,4-triazol-3-amine |
| SMILES | Nc1n[nH]c(-c2nn3c(C4CCOC4)nnc3s2)n1 |
| InChI | InChI=1S/C9H10N8OS/c10-8-11-5(12-14-8)7-16-17-6(4-1-2-18-3-4)13-15-9(17)19-7/h4H,1-3H2,(H3,10,11,12,14) |
| InChIKey | MPZGYECTCUHCOW-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 119.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |