C12H14N6OS2 — CID 114354991
1-[4-[3-(oxolan-3-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]-1,3-thiazol-2-yl]ethanamine (PubChem CID 114354991) has the molecular formula C12H14N6OS2 and a molecular weight of 322.42 g/mol. Its IUPAC name is 1-[4-[3-(oxolan-3-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]-1,3-thiazol-2-yl]ethanamine.
| Compound Name | 1-[4-[3-(oxolan-3-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]-1,3-thiazol-2-yl]ethanamine |
|---|---|
| PubChem CID | 114354991 |
| Molecular Formula | C12H14N6OS2 |
| Molecular Weight | 322.42 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | 1-[4-[3-(oxolan-3-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]-1,3-thiazol-2-yl]ethanamine |
| SMILES | CC(N)c1nc(-c2nn3c(C4CCOC4)nnc3s2)cs1 |
| InChI | InChI=1S/C12H14N6OS2/c1-6(13)10-14-8(5-20-10)11-17-18-9(7-2-3-19-4-7)15-16-12(18)21-11/h5-7H,2-4,13H2,1H3 |
| InChIKey | NZARDSXIEGVSFG-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.42 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |