C12H22O2 — CID 11435563
(4R,5S)-2,2,5-trimethyl-4-pent-4-enyl-1,3-dioxane (PubChem CID 11435563) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is (4R,5S)-2,2,5-trimethyl-4-pent-4-enyl-1,3-dioxane.
| Compound Name | (4R,5S)-2,2,5-trimethyl-4-pent-4-enyl-1,3-dioxane |
|---|---|
| PubChem CID | 11435563 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | (4R,5S)-2,2,5-trimethyl-4-pent-4-enyl-1,3-dioxane |
| SMILES | C=CCCC[C@H]1OC(C)(C)OC[C@@H]1C |
| InChI | InChI=1S/C12H22O2/c1-5-6-7-8-11-10(2)9-13-12(3,4)14-11/h5,10-11H,1,6-9H2,2-4H3/t10-,11+/m0/s1 |
| InChIKey | PDSKSUMDUAHCSY-WDEREUQCSA-N |
| XLogP | 3.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|