C9H18F3NO2 — CID 114357803
3-amino-5-methyl-2-(2,2,2-trifluoroethoxy)hexan-1-ol (PubChem CID 114357803) has the molecular formula C9H18F3NO2 and a molecular weight of 229.24 g/mol. Its IUPAC name is 3-amino-5-methyl-2-(2,2,2-trifluoroethoxy)hexan-1-ol.
| Compound Name | 3-amino-5-methyl-2-(2,2,2-trifluoroethoxy)hexan-1-ol |
|---|---|
| PubChem CID | 114357803 |
| Molecular Formula | C9H18F3NO2 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | 3-amino-5-methyl-2-(2,2,2-trifluoroethoxy)hexan-1-ol |
| SMILES | CC(C)CC(N)C(CO)OCC(F)(F)F |
| InChI | InChI=1S/C9H18F3NO2/c1-6(2)3-7(13)8(4-14)15-5-9(10,11)12/h6-8,14H,3-5,13H2,1-2H3 |
| InChIKey | WFYYQKPYISQMBE-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |