C15H23NO5 — CID 114358382
3-amino-3-cyclopropyl-2-(3,4,5-trimethoxyphenoxy)propan-1-ol (PubChem CID 114358382) has the molecular formula C15H23NO5 and a molecular weight of 297.35 g/mol. Its IUPAC name is 3-amino-3-cyclopropyl-2-(3,4,5-trimethoxyphenoxy)propan-1-ol.
| Compound Name | 3-amino-3-cyclopropyl-2-(3,4,5-trimethoxyphenoxy)propan-1-ol |
|---|---|
| PubChem CID | 114358382 |
| Molecular Formula | C15H23NO5 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 3-amino-3-cyclopropyl-2-(3,4,5-trimethoxyphenoxy)propan-1-ol |
| SMILES | COc1cc(OC(CO)C(N)C2CC2)cc(OC)c1OC |
| InChI | InChI=1S/C15H23NO5/c1-18-11-6-10(7-12(19-2)15(11)20-3)21-13(8-17)14(16)9-4-5-9/h6-7,9,13-14,17H,4-5,8,16H2,1-3H3 |
| InChIKey | MZPVXJDXYBGPEH-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 83.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |