C11H17NO4 — CID 11436096
(3aR,4R,8aR,8bS)-4-(hydroxymethyl)-2,2-dimethyl-3a,4,7,8,8a,8b-hexahydro-[1,3]dioxolo[4,5-a]pyrrolizin-6-one (PubChem CID 11436096) has the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. Its IUPAC name is (3aR,4R,8aR,8bS)-4-(hydroxymethyl)-2,2-dimethyl-3a,4,7,8,8a,8b-hexahydro-[1,3]dioxolo[4,5-a]pyrrolizin-6-one.
| Compound Name | (3aR,4R,8aR,8bS)-4-(hydroxymethyl)-2,2-dimethyl-3a,4,7,8,8a,8b-hexahydro-[1,3]dioxolo[4,5-a]pyrrolizin-6-one |
|---|---|
| PubChem CID | 11436096 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | (3aR,4R,8aR,8bS)-4-(hydroxymethyl)-2,2-dimethyl-3a,4,7,8,8a,8b-hexahydro-[1,3]dioxolo[4,5-a]pyrrolizin-6-one |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](CO)N1C(=O)CC[C@H]21 |
| InChI | InChI=1S/C11H17NO4/c1-11(2)15-9-6-3-4-8(14)12(6)7(5-13)10(9)16-11/h6-7,9-10,13H,3-5H2,1-2H3/t6-,7-,9+,10-/m1/s1 |
| InChIKey | NRZFTONLZVLHKO-GTDKDYCYSA-N |
| XLogP | -0.13 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |