C14H18ClNO2 — CID 11437090
(2-chloro-3-pyridinyl)methyl 2,2,3,3-tetramethylcyclopropane-1-carboxylate (PubChem CID 11437090) has the molecular formula C14H18ClNO2 and a molecular weight of 267.76 g/mol. Its IUPAC name is (2-chloro-3-pyridinyl)methyl 2,2,3,3-tetramethylcyclopropane-1-carboxylate.
| Compound Name | (2-chloro-3-pyridinyl)methyl 2,2,3,3-tetramethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 11437090 |
| Molecular Formula | C14H18ClNO2 |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | (2-chloro-3-pyridinyl)methyl 2,2,3,3-tetramethylcyclopropane-1-carboxylate |
| SMILES | CC1(C)C(C(=O)OCc2cccnc2Cl)C1(C)C |
| InChI | InChI=1S/C14H18ClNO2/c1-13(2)10(14(13,3)4)12(17)18-8-9-6-5-7-16-11(9)15/h5-7,10H,8H2,1-4H3 |
| InChIKey | NAJKGDLHYQUORA-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|