C24H23ClN6O2S — CID 1143716
(2R)-N-benzyl-2-(4-chloro-N-[2-(5-thiophen-2-yltetrazol-2-yl)acetyl]anilino)butanamide (PubChem CID 1143716) has the molecular formula C24H23ClN6O2S and a molecular weight of 495.01 g/mol. Its IUPAC name is (2R)-N-benzyl-2-(4-chloro-N-[2-(5-thiophen-2-yltetrazol-2-yl)acetyl]anilino)butanamide.
| Compound Name | (2R)-N-benzyl-2-(4-chloro-N-[2-(5-thiophen-2-yltetrazol-2-yl)acetyl]anilino)butanamide |
|---|---|
| PubChem CID | 1143716 |
| Molecular Formula | C24H23ClN6O2S |
| Molecular Weight | 495.01 g/mol |
| Exact Mass | 494.13 |
| IUPAC Name | (2R)-N-benzyl-2-(4-chloro-N-[2-(5-thiophen-2-yltetrazol-2-yl)acetyl]anilino)butanamide |
| SMILES | CC[C@H](C(=O)NCc1ccccc1)N(C(=O)Cn1nnc(-c2cccs2)n1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H23ClN6O2S/c1-2-20(24(33)26-15-17-7-4-3-5-8-17)31(19-12-10-18(25)11-13-19)22(32)16-30-28-23(27-29-30)21-9-6-14-34-21/h3-14,20H,2,15-16H2,1H3,(H,26,33)/t20-/m1/s1 |
| InChIKey | UXFKUAKTFIWYPZ-HXUWFJFHSA-N |
| XLogP | 4.18 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.01 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |