C24H30N6O2S — CID 3190185
N-benzyl-2-[cyclohexyl-[2-(5-thiophen-2-yltetrazol-2-yl)acetyl]amino]butanamide (PubChem CID 3190185) has the molecular formula C24H30N6O2S and a molecular weight of 466.61 g/mol. Its IUPAC name is N-benzyl-2-[cyclohexyl-[2-(5-thiophen-2-yltetrazol-2-yl)acetyl]amino]butanamide.
| Compound Name | N-benzyl-2-[cyclohexyl-[2-(5-thiophen-2-yltetrazol-2-yl)acetyl]amino]butanamide |
|---|---|
| PubChem CID | 3190185 |
| Molecular Formula | C24H30N6O2S |
| Molecular Weight | 466.61 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | N-benzyl-2-[cyclohexyl-[2-(5-thiophen-2-yltetrazol-2-yl)acetyl]amino]butanamide |
| SMILES | CCC(C(=O)NCc1ccccc1)N(C(=O)Cn1nnc(-c2cccs2)n1)C1CCCCC1 |
| InChI | InChI=1S/C24H30N6O2S/c1-2-20(24(32)25-16-18-10-5-3-6-11-18)30(19-12-7-4-8-13-19)22(31)17-29-27-23(26-28-29)21-14-9-15-33-21/h3,5-6,9-11,14-15,19-20H,2,4,7-8,12-13,16-17H2,1H3,(H,25,32) |
| InChIKey | IIKTYZZODCJUCG-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.61 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |