C25H26N6O3S — CID 1143718
(2S)-N-benzyl-2-(2-methoxy-N-[2-(5-thiophen-2-yltetrazol-2-yl)acetyl]anilino)butanamide (PubChem CID 1143718) has the molecular formula C25H26N6O3S and a molecular weight of 490.59 g/mol. Its IUPAC name is (2S)-N-benzyl-2-(2-methoxy-N-[2-(5-thiophen-2-yltetrazol-2-yl)acetyl]anilino)butanamide.
| Compound Name | (2S)-N-benzyl-2-(2-methoxy-N-[2-(5-thiophen-2-yltetrazol-2-yl)acetyl]anilino)butanamide |
|---|---|
| PubChem CID | 1143718 |
| Molecular Formula | C25H26N6O3S |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | (2S)-N-benzyl-2-(2-methoxy-N-[2-(5-thiophen-2-yltetrazol-2-yl)acetyl]anilino)butanamide |
| SMILES | CC[C@@H](C(=O)NCc1ccccc1)N(C(=O)Cn1nnc(-c2cccs2)n1)c1ccccc1OC |
| InChI | InChI=1S/C25H26N6O3S/c1-3-19(25(33)26-16-18-10-5-4-6-11-18)31(20-12-7-8-13-21(20)34-2)23(32)17-30-28-24(27-29-30)22-14-9-15-35-22/h4-15,19H,3,16-17H2,1-2H3,(H,26,33)/t19-/m0/s1 |
| InChIKey | WHGBJUIWGYRYIW-IBGZPJMESA-N |
| XLogP | 3.54 |
| TPSA | 102.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |