C13H10ClN3O2 — CID 11437318
methyl 3-amino-4-chloro-1H-pyrrolo[3,2-c]quinoline-2-carboxylate (PubChem CID 11437318) has the molecular formula C13H10ClN3O2 and a molecular weight of 275.70 g/mol. Its IUPAC name is methyl 3-amino-4-chloro-1H-pyrrolo[3,2-c]quinoline-2-carboxylate.
| Compound Name | methyl 3-amino-4-chloro-1H-pyrrolo[3,2-c]quinoline-2-carboxylate |
|---|---|
| PubChem CID | 11437318 |
| Molecular Formula | C13H10ClN3O2 |
| Molecular Weight | 275.70 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | methyl 3-amino-4-chloro-1H-pyrrolo[3,2-c]quinoline-2-carboxylate |
| SMILES | COC(=O)c1[nH]c2c(c(Cl)nc3ccccc32)c1N |
| InChI | InChI=1S/C13H10ClN3O2/c1-19-13(18)11-9(15)8-10(17-11)6-4-2-3-5-7(6)16-12(8)14/h2-5,17H,15H2,1H3 |
| InChIKey | UYKUKQKFWJPAHC-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.70 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|