C10H7ClN4 — CID 87165995
4-chloro-3H-imidazo[4,5-c]quinolin-2-amine (PubChem CID 87165995) has the molecular formula C10H7ClN4 and a molecular weight of 218.65 g/mol. Its IUPAC name is 4-chloro-3H-imidazo[4,5-c]quinolin-2-amine.
| Compound Name | 4-chloro-3H-imidazo[4,5-c]quinolin-2-amine |
|---|---|
| PubChem CID | 87165995 |
| Molecular Formula | C10H7ClN4 |
| Molecular Weight | 218.65 g/mol |
| Exact Mass | 218.04 |
| IUPAC Name | 4-chloro-3H-imidazo[4,5-c]quinolin-2-amine |
| SMILES | Nc1nc2c([nH]1)c(Cl)nc1ccccc12 |
| InChI | InChI=1S/C10H7ClN4/c11-9-8-7(14-10(12)15-8)5-3-1-2-4-6(5)13-9/h1-4H,(H3,12,14,15) |
| InChIKey | OUNSXWGLPICNRT-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.65 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|