C16H24O4 — CID 11437451
(2R,3S)-3-[(E)-6-[(1R,5R)-6,8-dioxabicyclo[3.2.1]octan-5-yl]-3-methylhex-3-enyl]oxirane-2-carbaldehyde (PubChem CID 11437451) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is (2R,3S)-3-[(E)-6-[(1R,5R)-6,8-dioxabicyclo[3.2.1]octan-5-yl]-3-methylhex-3-enyl]oxirane-2-carbaldehyde.
| Compound Name | (2R,3S)-3-[(E)-6-[(1R,5R)-6,8-dioxabicyclo[3.2.1]octan-5-yl]-3-methylhex-3-enyl]oxirane-2-carbaldehyde |
|---|---|
| PubChem CID | 11437451 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | (2R,3S)-3-[(E)-6-[(1R,5R)-6,8-dioxabicyclo[3.2.1]octan-5-yl]-3-methylhex-3-enyl]oxirane-2-carbaldehyde |
| SMILES | C/C(=C\CC[C@]12CCC[C@H](CO1)O2)CC[C@@H]1O[C@H]1C=O |
| InChI | InChI=1S/C16H24O4/c1-12(6-7-14-15(10-17)19-14)4-2-8-16-9-3-5-13(20-16)11-18-16/h4,10,13-15H,2-3,5-9,11H2,1H3/b12-4+/t13-,14+,15+,16+/m1/s1 |
| InChIKey | BYECVCAFZOAZKX-HCVPMSHCSA-N |
| XLogP | 2.76 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|