C15H20FNS — CID 114378107
N-[(7-fluoro-3-propyl-1-benzothiophen-2-yl)methyl]propan-2-amine (PubChem CID 114378107) has the molecular formula C15H20FNS and a molecular weight of 265.40 g/mol. Its IUPAC name is N-[(7-fluoro-3-propyl-1-benzothiophen-2-yl)methyl]propan-2-amine.
| Compound Name | N-[(7-fluoro-3-propyl-1-benzothiophen-2-yl)methyl]propan-2-amine |
|---|---|
| PubChem CID | 114378107 |
| Molecular Formula | C15H20FNS |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | N-[(7-fluoro-3-propyl-1-benzothiophen-2-yl)methyl]propan-2-amine |
| SMILES | CCCc1c(CNC(C)C)sc2c(F)cccc12 |
| InChI | InChI=1S/C15H20FNS/c1-4-6-11-12-7-5-8-13(16)15(12)18-14(11)9-17-10(2)3/h5,7-8,10,17H,4,6,9H2,1-3H3 |
| InChIKey | VXRSQZGKBZXUKK-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |