C16H22O5 — CID 11437845
[(4S,8aR,12S,12aR)-4-methyl-2,9-dioxo-4,5,6,7,8,8a,12,12a-octahydro-1H-3-benzoxecin-12-yl] acetate (PubChem CID 11437845) has the molecular formula C16H22O5 and a molecular weight of 294.35 g/mol. Its IUPAC name is [(4S,8aR,12S,12aR)-4-methyl-2,9-dioxo-4,5,6,7,8,8a,12,12a-octahydro-1H-3-benzoxecin-12-yl] acetate.
| Compound Name | [(4S,8aR,12S,12aR)-4-methyl-2,9-dioxo-4,5,6,7,8,8a,12,12a-octahydro-1H-3-benzoxecin-12-yl] acetate |
|---|---|
| PubChem CID | 11437845 |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | [(4S,8aR,12S,12aR)-4-methyl-2,9-dioxo-4,5,6,7,8,8a,12,12a-octahydro-1H-3-benzoxecin-12-yl] acetate |
| SMILES | CC(=O)O[C@H]1C=CC(=O)[C@@H]2CCCC[C@H](C)OC(=O)C[C@@H]12 |
| InChI | InChI=1S/C16H22O5/c1-10-5-3-4-6-12-13(9-16(19)20-10)15(21-11(2)17)8-7-14(12)18/h7-8,10,12-13,15H,3-6,9H2,1-2H3/t10-,12+,13+,15-/m0/s1 |
| InChIKey | NRSTXBXHZACGTE-ZGFBFQLVSA-N |
| XLogP | 2.19 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |