C13H15BrN2O4 — CID 114382042
3-[(4-bromo-2-nitrophenyl)methyl-cyclopropylamino]propanoic acid (PubChem CID 114382042) has the molecular formula C13H15BrN2O4 and a molecular weight of 343.18 g/mol. Its IUPAC name is 3-[(4-bromo-2-nitrophenyl)methyl-cyclopropylamino]propanoic acid.
| Compound Name | 3-[(4-bromo-2-nitrophenyl)methyl-cyclopropylamino]propanoic acid |
|---|---|
| PubChem CID | 114382042 |
| Molecular Formula | C13H15BrN2O4 |
| Molecular Weight | 343.18 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | 3-[(4-bromo-2-nitrophenyl)methyl-cyclopropylamino]propanoic acid |
| SMILES | O=C(O)CCN(Cc1ccc(Br)cc1[N+](=O)[O-])C1CC1 |
| InChI | InChI=1S/C13H15BrN2O4/c14-10-2-1-9(12(7-10)16(19)20)8-15(11-3-4-11)6-5-13(17)18/h1-2,7,11H,3-6,8H2,(H,17,18) |
| InChIKey | JQQJJHKUAPOITL-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.18 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|