C13H17NO4 — CID 65054781
3-[cyclopropyl-[(2,4-dihydroxyphenyl)methyl]amino]propanoic acid (PubChem CID 65054781) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is 3-[cyclopropyl-[(2,4-dihydroxyphenyl)methyl]amino]propanoic acid.
| Compound Name | 3-[cyclopropyl-[(2,4-dihydroxyphenyl)methyl]amino]propanoic acid |
|---|---|
| PubChem CID | 65054781 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 3-[cyclopropyl-[(2,4-dihydroxyphenyl)methyl]amino]propanoic acid |
| SMILES | O=C(O)CCN(Cc1ccc(O)cc1O)C1CC1 |
| InChI | InChI=1S/C13H17NO4/c15-11-4-1-9(12(16)7-11)8-14(10-2-3-10)6-5-13(17)18/h1,4,7,10,15-16H,2-3,5-6,8H2,(H,17,18) |
| InChIKey | DIVRQFUFPGPKQD-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|