About N-(3-amino-2,2-difluoropropyl)-1-benzylpyrrole-2-carboxamide
N-(3-amino-2,2-difluoropropyl)-1-benzylpyrrole-2-carboxamide (PubChem CID 114383386) has the molecular formula C15H17F2N3O
and a molecular weight of 293.32 g/mol. Its IUPAC name is N-(3-amino-2,2-difluoropropyl)-1-benzylpyrrole-2-carboxamide.
Molecular Properties
| Compound Name | N-(3-amino-2,2-difluoropropyl)-1-benzylpyrrole-2-carboxamide |
| PubChem CID | 114383386 |
| Molecular Formula | C15H17F2N3O |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | N-(3-amino-2,2-difluoropropyl)-1-benzylpyrrole-2-carboxamide |
| SMILES | NCC(F)(F)CNC(=O)c1cccn1Cc1ccccc1 |
| InChI | InChI=1S/C15H17F2N3O/c16-15(17,10-18)11-19-14(21)13-7-4-8-20(13)9-12-5-2-1-3-6-12/h1-8H,9-11,18H2,(H,19,21) |
| InChIKey | XQXMXSVQKQRTFJ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(3-amino-2,2-difluoropropyl)-1-benzylpyrrole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-amino-2,2-difluoropropyl)-1-benzylpyrrole-2-carboxamide?
The IUPAC name of N-(3-amino-2,2-difluoropropyl)-1-benzylpyrrole-2-carboxamide (CID 114383386) is N-(3-amino-2,2-difluoropropyl)-1-benzylpyrrole-2-carboxamide.
What is the SMILES notation for N-(3-amino-2,2-difluoropropyl)-1-benzylpyrrole-2-carboxamide?
The canonical SMILES for N-(3-amino-2,2-difluoropropyl)-1-benzylpyrrole-2-carboxamide is NCC(F)(F)CNC(=O)c1cccn1Cc1ccccc1.
What is the InChIKey of N-(3-amino-2,2-difluoropropyl)-1-benzylpyrrole-2-carboxamide?
The InChIKey is XQXMXSVQKQRTFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17F2N3O/c16-15(17,10-18)11-19-14(21)13-7-4-8-20(13)9-12-5-2-1-3-6-12/h1-8H,9-11,18H2,(H,19,21).
What are the key properties of N-(3-amino-2,2-difluoropropyl)-1-benzylpyrrole-2-carboxamide?
N-(3-amino-2,2-difluoropropyl)-1-benzylpyrrole-2-carboxamide has a molecular weight of 293.32 g/mol, XLogP of 1.86, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-amino-2,2-difluoropropyl)-1-benzylpyrrole-2-carboxamide is sourced from PubChem (CID 114383386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).