C17H32O3Si — CID 11438377
tert-butyl-[(1E,3Z)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]hexa-1,3-dien-3-yl]oxy-dimethylsilane (PubChem CID 11438377) has the molecular formula C17H32O3Si and a molecular weight of 312.53 g/mol. Its IUPAC name is tert-butyl-[(1E,3Z)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]hexa-1,3-dien-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1E,3Z)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]hexa-1,3-dien-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 11438377 |
| Molecular Formula | C17H32O3Si |
| Molecular Weight | 312.53 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | tert-butyl-[(1E,3Z)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]hexa-1,3-dien-3-yl]oxy-dimethylsilane |
| SMILES | CC/C=C(/C=C/[C@H]1COC(C)(C)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H32O3Si/c1-9-10-14(20-21(7,8)16(2,3)4)11-12-15-13-18-17(5,6)19-15/h10-12,15H,9,13H2,1-8H3/b12-11+,14-10-/t15-/m0/s1 |
| InChIKey | DMUVEMJLMAMSJI-FTBMHMGTSA-N |
| XLogP | 5.01 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.53 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|