C10H20F2N2O2S — CID 114384068
N-(3-amino-2,2-difluoropropyl)-1-cyclohexylmethanesulfonamide (PubChem CID 114384068) has the molecular formula C10H20F2N2O2S and a molecular weight of 270.34 g/mol. Its IUPAC name is N-(3-amino-2,2-difluoropropyl)-1-cyclohexylmethanesulfonamide.
| Compound Name | N-(3-amino-2,2-difluoropropyl)-1-cyclohexylmethanesulfonamide |
|---|---|
| PubChem CID | 114384068 |
| Molecular Formula | C10H20F2N2O2S |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | N-(3-amino-2,2-difluoropropyl)-1-cyclohexylmethanesulfonamide |
| SMILES | NCC(F)(F)CNS(=O)(=O)CC1CCCCC1 |
| InChI | InChI=1S/C10H20F2N2O2S/c11-10(12,7-13)8-14-17(15,16)6-9-4-2-1-3-5-9/h9,14H,1-8,13H2 |
| InChIKey | SKHZETCMZJJHDY-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |