C11H20F3NO2S — CID 172528636
N-propan-2-yl-1-[4-(trifluoromethyl)cyclohexyl]methanesulfonamide (PubChem CID 172528636) has the molecular formula C11H20F3NO2S and a molecular weight of 287.35 g/mol. Its IUPAC name is N-propan-2-yl-1-[4-(trifluoromethyl)cyclohexyl]methanesulfonamide.
| Compound Name | N-propan-2-yl-1-[4-(trifluoromethyl)cyclohexyl]methanesulfonamide |
|---|---|
| PubChem CID | 172528636 |
| Molecular Formula | C11H20F3NO2S |
| Molecular Weight | 287.35 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | N-propan-2-yl-1-[4-(trifluoromethyl)cyclohexyl]methanesulfonamide |
| SMILES | CC(C)NS(=O)(=O)CC1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C11H20F3NO2S/c1-8(2)15-18(16,17)7-9-3-5-10(6-4-9)11(12,13)14/h8-10,15H,3-7H2,1-2H3 |
| InChIKey | PCLJDHYNAWKOCN-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |