C12H11BrO3S — CID 11438433
3-(benzenesulfinyl)-4-bromo-5,5-dimethylfuran-2-one (PubChem CID 11438433) has the molecular formula C12H11BrO3S and a molecular weight of 315.19 g/mol. Its IUPAC name is 3-(benzenesulfinyl)-4-bromo-5,5-dimethylfuran-2-one.
| Compound Name | 3-(benzenesulfinyl)-4-bromo-5,5-dimethylfuran-2-one |
|---|---|
| PubChem CID | 11438433 |
| Molecular Formula | C12H11BrO3S |
| Molecular Weight | 315.19 g/mol |
| Exact Mass | 313.96 |
| IUPAC Name | 3-(benzenesulfinyl)-4-bromo-5,5-dimethylfuran-2-one |
| SMILES | CC1(C)OC(=O)C(S(=O)c2ccccc2)=C1Br |
| InChI | InChI=1S/C12H11BrO3S/c1-12(2)10(13)9(11(14)16-12)17(15)8-6-4-3-5-7-8/h3-7H,1-2H3 |
| InChIKey | WLFBVCZKQSWWBZ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.19 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |