C14H17BrOS — CID 13171793
3-bromo-2,2,5,5-tetramethyl-4-phenylsulfanylfuran (PubChem CID 13171793) has the molecular formula C14H17BrOS and a molecular weight of 313.26 g/mol. Its IUPAC name is 3-bromo-2,2,5,5-tetramethyl-4-phenylsulfanylfuran.
| Compound Name | 3-bromo-2,2,5,5-tetramethyl-4-phenylsulfanylfuran |
|---|---|
| PubChem CID | 13171793 |
| Molecular Formula | C14H17BrOS |
| Molecular Weight | 313.26 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | 3-bromo-2,2,5,5-tetramethyl-4-phenylsulfanylfuran |
| SMILES | CC1(C)OC(C)(C)C(Sc2ccccc2)=C1Br |
| InChI | InChI=1S/C14H17BrOS/c1-13(2)11(15)12(14(3,4)16-13)17-10-8-6-5-7-9-10/h5-9H,1-4H3 |
| InChIKey | MSADMULHAFUVGB-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.26 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |