C13H16OS — CID 13171798
6,6-dimethyl-4-phenylsulfanyl-2,3-dihydropyran (PubChem CID 13171798) has the molecular formula C13H16OS and a molecular weight of 220.34 g/mol. Its IUPAC name is 6,6-dimethyl-4-phenylsulfanyl-2,3-dihydropyran.
| Compound Name | 6,6-dimethyl-4-phenylsulfanyl-2,3-dihydropyran |
|---|---|
| PubChem CID | 13171798 |
| Molecular Formula | C13H16OS |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | 6,6-dimethyl-4-phenylsulfanyl-2,3-dihydropyran |
| SMILES | CC1(C)C=C(Sc2ccccc2)CCO1 |
| InChI | InChI=1S/C13H16OS/c1-13(2)10-12(8-9-14-13)15-11-6-4-3-5-7-11/h3-7,10H,8-9H2,1-2H3 |
| InChIKey | XWEBLEHBNKFSBS-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |