C10H22N2O3S — CID 114385265
2-[(1-hydroxy-3-methylcyclohexyl)methylamino]ethanesulfonamide (PubChem CID 114385265) has the molecular formula C10H22N2O3S and a molecular weight of 250.36 g/mol. Its IUPAC name is 2-[(1-hydroxy-3-methylcyclohexyl)methylamino]ethanesulfonamide.
| Compound Name | 2-[(1-hydroxy-3-methylcyclohexyl)methylamino]ethanesulfonamide |
|---|---|
| PubChem CID | 114385265 |
| Molecular Formula | C10H22N2O3S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 2-[(1-hydroxy-3-methylcyclohexyl)methylamino]ethanesulfonamide |
| SMILES | CC1CCCC(O)(CNCCS(N)(=O)=O)C1 |
| InChI | InChI=1S/C10H22N2O3S/c1-9-3-2-4-10(13,7-9)8-12-5-6-16(11,14)15/h9,12-13H,2-8H2,1H3,(H2,11,14,15) |
| InChIKey | BUKDGLMCPRZBHF-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|