C12H23NO5S — CID 65121496
methyl 3-[(1-hydroxy-3-methylcyclohexyl)methylsulfamoyl]propanoate (PubChem CID 65121496) has the molecular formula C12H23NO5S and a molecular weight of 293.38 g/mol. Its IUPAC name is methyl 3-[(1-hydroxy-3-methylcyclohexyl)methylsulfamoyl]propanoate.
| Compound Name | methyl 3-[(1-hydroxy-3-methylcyclohexyl)methylsulfamoyl]propanoate |
|---|---|
| PubChem CID | 65121496 |
| Molecular Formula | C12H23NO5S |
| Molecular Weight | 293.38 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | methyl 3-[(1-hydroxy-3-methylcyclohexyl)methylsulfamoyl]propanoate |
| SMILES | COC(=O)CCS(=O)(=O)NCC1(O)CCCC(C)C1 |
| InChI | InChI=1S/C12H23NO5S/c1-10-4-3-6-12(15,8-10)9-13-19(16,17)7-5-11(14)18-2/h10,13,15H,3-9H2,1-2H3 |
| InChIKey | CSWPXHJMXYDIGR-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.38 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |