C10H11BrN2O2S — CID 114385721
2-(4-bromo-2-nitrophenyl)-5-methyl-1,3-thiazolidine (PubChem CID 114385721) has the molecular formula C10H11BrN2O2S and a molecular weight of 303.18 g/mol. Its IUPAC name is 2-(4-bromo-2-nitrophenyl)-5-methyl-1,3-thiazolidine.
| Compound Name | 2-(4-bromo-2-nitrophenyl)-5-methyl-1,3-thiazolidine |
|---|---|
| PubChem CID | 114385721 |
| Molecular Formula | C10H11BrN2O2S |
| Molecular Weight | 303.18 g/mol |
| Exact Mass | 301.97 |
| IUPAC Name | 2-(4-bromo-2-nitrophenyl)-5-methyl-1,3-thiazolidine |
| SMILES | CC1CNC(c2ccc(Br)cc2[N+](=O)[O-])S1 |
| InChI | InChI=1S/C10H11BrN2O2S/c1-6-5-12-10(16-6)8-3-2-7(11)4-9(8)13(14)15/h2-4,6,10,12H,5H2,1H3 |
| InChIKey | ZGBVLSJHFQYKIK-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.18 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|