C10H10BrNO2 — CID 28592942
4-bromo-1-[(1S,2R)-2-methylcyclopropyl]-2-nitrobenzene (PubChem CID 28592942) has the molecular formula C10H10BrNO2 and a molecular weight of 256.10 g/mol. Its IUPAC name is 4-bromo-1-[(1S,2R)-2-methylcyclopropyl]-2-nitrobenzene.
| Compound Name | 4-bromo-1-[(1S,2R)-2-methylcyclopropyl]-2-nitrobenzene |
|---|---|
| PubChem CID | 28592942 |
| Molecular Formula | C10H10BrNO2 |
| Molecular Weight | 256.10 g/mol |
| Exact Mass | 254.99 |
| IUPAC Name | 4-bromo-1-[(1S,2R)-2-methylcyclopropyl]-2-nitrobenzene |
| SMILES | C[C@@H]1C[C@@H]1c1ccc(Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H10BrNO2/c1-6-4-9(6)8-3-2-7(11)5-10(8)12(13)14/h2-3,5-6,9H,4H2,1H3/t6-,9+/m1/s1 |
| InChIKey | RUXYGSMSWHYDEH-MUWHJKNJSA-N |
| XLogP | 3.48 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.10 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|