C20H32OS — CID 11438607
(E,3S,4S)-5-hexylsulfanyl-4-methyl-3-phenylhept-5-en-1-ol (PubChem CID 11438607) has the molecular formula C20H32OS and a molecular weight of 320.54 g/mol. Its IUPAC name is (E,3S,4S)-5-hexylsulfanyl-4-methyl-3-phenylhept-5-en-1-ol.
| Compound Name | (E,3S,4S)-5-hexylsulfanyl-4-methyl-3-phenylhept-5-en-1-ol |
|---|---|
| PubChem CID | 11438607 |
| Molecular Formula | C20H32OS |
| Molecular Weight | 320.54 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | (E,3S,4S)-5-hexylsulfanyl-4-methyl-3-phenylhept-5-en-1-ol |
| SMILES | C/C=C(/SCCCCCC)[C@@H](C)[C@H](CCO)c1ccccc1 |
| InChI | InChI=1S/C20H32OS/c1-4-6-7-11-16-22-20(5-2)17(3)19(14-15-21)18-12-9-8-10-13-18/h5,8-10,12-13,17,19,21H,4,6-7,11,14-16H2,1-3H3/b20-5+/t17-,19-/m0/s1 |
| InChIKey | CQLUADPPFLEJIC-IKXORMRUSA-N |
| XLogP | 6.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.54 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|