C13H13BrFN3O — CID 114386191
5-bromo-4-[1-(3-fluoro-4-methylphenyl)ethylamino]-1H-pyridazin-6-one (PubChem CID 114386191) has the molecular formula C13H13BrFN3O and a molecular weight of 326.17 g/mol. Its IUPAC name is 5-bromo-4-[1-(3-fluoro-4-methylphenyl)ethylamino]-1H-pyridazin-6-one.
| Compound Name | 5-bromo-4-[1-(3-fluoro-4-methylphenyl)ethylamino]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 114386191 |
| Molecular Formula | C13H13BrFN3O |
| Molecular Weight | 326.17 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | 5-bromo-4-[1-(3-fluoro-4-methylphenyl)ethylamino]-1H-pyridazin-6-one |
| SMILES | Cc1ccc(C(C)Nc2cn[nH]c(=O)c2Br)cc1F |
| InChI | InChI=1S/C13H13BrFN3O/c1-7-3-4-9(5-10(7)15)8(2)17-11-6-16-18-13(19)12(11)14/h3-6,8H,1-2H3,(H2,17,18,19) |
| InChIKey | YFMQRUQJOXOVNS-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.17 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |