C14H16BrN3O3 — CID 114385970
5-bromo-4-[1-(3,4-dimethoxyphenyl)ethylamino]-1H-pyridazin-6-one (PubChem CID 114385970) has the molecular formula C14H16BrN3O3 and a molecular weight of 354.20 g/mol. Its IUPAC name is 5-bromo-4-[1-(3,4-dimethoxyphenyl)ethylamino]-1H-pyridazin-6-one.
| Compound Name | 5-bromo-4-[1-(3,4-dimethoxyphenyl)ethylamino]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 114385970 |
| Molecular Formula | C14H16BrN3O3 |
| Molecular Weight | 354.20 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | 5-bromo-4-[1-(3,4-dimethoxyphenyl)ethylamino]-1H-pyridazin-6-one |
| SMILES | COc1ccc(C(C)Nc2cn[nH]c(=O)c2Br)cc1OC |
| InChI | InChI=1S/C14H16BrN3O3/c1-8(17-10-7-16-18-14(19)13(10)15)9-4-5-11(20-2)12(6-9)21-3/h4-8H,1-3H3,(H2,17,18,19) |
| InChIKey | YYQRNIZLHVTPSN-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.20 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |