C19H24BrN3O3 — CID 133303502
4-bromo-5-[1-(4-cyclopentyloxy-3-methoxyphenyl)ethylamino]-2-methylpyridazin-3-one (PubChem CID 133303502) has the molecular formula C19H24BrN3O3 and a molecular weight of 422.32 g/mol. Its IUPAC name is 4-bromo-5-[1-(4-cyclopentyloxy-3-methoxyphenyl)ethylamino]-2-methylpyridazin-3-one.
| Compound Name | 4-bromo-5-[1-(4-cyclopentyloxy-3-methoxyphenyl)ethylamino]-2-methylpyridazin-3-one |
|---|---|
| PubChem CID | 133303502 |
| Molecular Formula | C19H24BrN3O3 |
| Molecular Weight | 422.32 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | 4-bromo-5-[1-(4-cyclopentyloxy-3-methoxyphenyl)ethylamino]-2-methylpyridazin-3-one |
| SMILES | COc1cc(C(C)Nc2cnn(C)c(=O)c2Br)ccc1OC1CCCC1 |
| InChI | InChI=1S/C19H24BrN3O3/c1-12(22-15-11-21-23(2)19(24)18(15)20)13-8-9-16(17(10-13)25-3)26-14-6-4-5-7-14/h8-12,14,22H,4-7H2,1-3H3 |
| InChIKey | ZRSORIRDFDSWOD-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.32 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |