C11H13ClN6O2S — CID 114387378
2-chloro-N-(5,6-diethyl-1,2,4-triazin-3-yl)pyrimidine-5-sulfonamide (PubChem CID 114387378) has the molecular formula C11H13ClN6O2S and a molecular weight of 328.79 g/mol. Its IUPAC name is 2-chloro-N-(5,6-diethyl-1,2,4-triazin-3-yl)pyrimidine-5-sulfonamide.
| Compound Name | 2-chloro-N-(5,6-diethyl-1,2,4-triazin-3-yl)pyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 114387378 |
| Molecular Formula | C11H13ClN6O2S |
| Molecular Weight | 328.79 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | 2-chloro-N-(5,6-diethyl-1,2,4-triazin-3-yl)pyrimidine-5-sulfonamide |
| SMILES | CCc1nnc(NS(=O)(=O)c2cnc(Cl)nc2)nc1CC |
| InChI | InChI=1S/C11H13ClN6O2S/c1-3-8-9(4-2)16-17-11(15-8)18-21(19,20)7-5-13-10(12)14-6-7/h5-6H,3-4H2,1-2H3,(H,15,17,18) |
| InChIKey | WSCGJRRLHRRASL-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 110.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.79 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |