C11H21N5O2S — CID 114388299
N-(5,6-diethyl-1,2,4-triazin-3-yl)-2-(ethylamino)ethanesulfonamide (PubChem CID 114388299) has the molecular formula C11H21N5O2S and a molecular weight of 287.39 g/mol. Its IUPAC name is N-(5,6-diethyl-1,2,4-triazin-3-yl)-2-(ethylamino)ethanesulfonamide.
| Compound Name | N-(5,6-diethyl-1,2,4-triazin-3-yl)-2-(ethylamino)ethanesulfonamide |
|---|---|
| PubChem CID | 114388299 |
| Molecular Formula | C11H21N5O2S |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | N-(5,6-diethyl-1,2,4-triazin-3-yl)-2-(ethylamino)ethanesulfonamide |
| SMILES | CCNCCS(=O)(=O)Nc1nnc(CC)c(CC)n1 |
| InChI | InChI=1S/C11H21N5O2S/c1-4-9-10(5-2)14-15-11(13-9)16-19(17,18)8-7-12-6-3/h12H,4-8H2,1-3H3,(H,13,15,16) |
| InChIKey | HVAFCRTVOOURPU-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|