C11H19ClN4O2S — CID 114389012
4-chloro-N-(5,6-diethyl-1,2,4-triazin-3-yl)butane-1-sulfonamide (PubChem CID 114389012) has the molecular formula C11H19ClN4O2S and a molecular weight of 306.82 g/mol. Its IUPAC name is 4-chloro-N-(5,6-diethyl-1,2,4-triazin-3-yl)butane-1-sulfonamide.
| Compound Name | 4-chloro-N-(5,6-diethyl-1,2,4-triazin-3-yl)butane-1-sulfonamide |
|---|---|
| PubChem CID | 114389012 |
| Molecular Formula | C11H19ClN4O2S |
| Molecular Weight | 306.82 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 4-chloro-N-(5,6-diethyl-1,2,4-triazin-3-yl)butane-1-sulfonamide |
| SMILES | CCc1nnc(NS(=O)(=O)CCCCCl)nc1CC |
| InChI | InChI=1S/C11H19ClN4O2S/c1-3-9-10(4-2)14-15-11(13-9)16-19(17,18)8-6-5-7-12/h3-8H2,1-2H3,(H,13,15,16) |
| InChIKey | JGRIYOHAXXRXJZ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.82 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|