C8H13ClN4O2S — CID 114389008
3-chloro-N-(5,6-dimethyl-1,2,4-triazin-3-yl)propane-1-sulfonamide (PubChem CID 114389008) has the molecular formula C8H13ClN4O2S and a molecular weight of 264.74 g/mol. Its IUPAC name is 3-chloro-N-(5,6-dimethyl-1,2,4-triazin-3-yl)propane-1-sulfonamide.
| Compound Name | 3-chloro-N-(5,6-dimethyl-1,2,4-triazin-3-yl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 114389008 |
| Molecular Formula | C8H13ClN4O2S |
| Molecular Weight | 264.74 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | 3-chloro-N-(5,6-dimethyl-1,2,4-triazin-3-yl)propane-1-sulfonamide |
| SMILES | Cc1nnc(NS(=O)(=O)CCCCl)nc1C |
| InChI | InChI=1S/C8H13ClN4O2S/c1-6-7(2)11-12-8(10-6)13-16(14,15)5-3-4-9/h3-5H2,1-2H3,(H,10,12,13) |
| InChIKey | PKILQEQKVAXCMC-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.74 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|