C10H20N6O2S — CID 106082972
5,6-dimethyl-3-[[methyl-[3-(methylamino)propyl]sulfamoyl]amino]-1,2,4-triazine (PubChem CID 106082972) has the molecular formula C10H20N6O2S and a molecular weight of 288.38 g/mol. Its IUPAC name is 5,6-dimethyl-3-[[methyl-[3-(methylamino)propyl]sulfamoyl]amino]-1,2,4-triazine.
| Compound Name | 5,6-dimethyl-3-[[methyl-[3-(methylamino)propyl]sulfamoyl]amino]-1,2,4-triazine |
|---|---|
| PubChem CID | 106082972 |
| Molecular Formula | C10H20N6O2S |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 5,6-dimethyl-3-[[methyl-[3-(methylamino)propyl]sulfamoyl]amino]-1,2,4-triazine |
| SMILES | CNCCCN(C)S(=O)(=O)Nc1nnc(C)c(C)n1 |
| InChI | InChI=1S/C10H20N6O2S/c1-8-9(2)13-14-10(12-8)15-19(17,18)16(4)7-5-6-11-3/h11H,5-7H2,1-4H3,(H,12,14,15) |
| InChIKey | IVJQLYSZDVLJGD-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|